Organic compounds

Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.


























Filtered Search Results

Potassium Hydrogen Phthalate (Primary Standard/Meets ACS Specifications), Fisher Chemical™
CAS: 877-24-7 Molecular Formula: C8H5KO4 Molecular Weight (g/mol): 204.222 MDL Number: MFCD00013070 InChI Key: IWZKICVEHNUQTL-UHFFFAOYSA-M Synonym: potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic PubChem CID: 23676735 IUPAC Name: potassium;2-carboxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+]
PubChem CID | 23676735 |
---|---|
CAS | 877-24-7 |
Molecular Weight (g/mol) | 204.222 |
MDL Number | MFCD00013070 |
SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
Synonym | potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic |
IUPAC Name | potassium;2-carboxybenzoate |
InChI Key | IWZKICVEHNUQTL-UHFFFAOYSA-M |
Molecular Formula | C8H5KO4 |
2-Aminoethyl hydrogen sulfate, 99%, Thermo Scientific Chemicals
CAS: 926-39-6 Molecular Formula: C2H7NO4S Molecular Weight (g/mol): 141.14 MDL Number: MFCD00008179 InChI Key: WSYUEVRAMDSJKL-UHFFFAOYSA-N Synonym: ethanolamine o-sulfate,aminoethyl sulfate,2-aminoethyl sulfate,mono 2-aminoethyl sulfate,2-aminoethyl hydrogen sulphate,sulfuric acid mono 2-aminoethyl ester,was-34,2-aminoethylhydrogensulfate,unii-9c8f910hlk,ethanol, 2-amino-, hydrogen sulfate ester PubChem CID: 70223 IUPAC Name: 2-aminoethyl hydrogen sulfate SMILES: NCCOS(O)(=O)=O
PubChem CID | 70223 |
---|---|
CAS | 926-39-6 |
Molecular Weight (g/mol) | 141.14 |
MDL Number | MFCD00008179 |
SMILES | NCCOS(O)(=O)=O |
Synonym | ethanolamine o-sulfate,aminoethyl sulfate,2-aminoethyl sulfate,mono 2-aminoethyl sulfate,2-aminoethyl hydrogen sulphate,sulfuric acid mono 2-aminoethyl ester,was-34,2-aminoethylhydrogensulfate,unii-9c8f910hlk,ethanol, 2-amino-, hydrogen sulfate ester |
IUPAC Name | 2-aminoethyl hydrogen sulfate |
InChI Key | WSYUEVRAMDSJKL-UHFFFAOYSA-N |
Molecular Formula | C2H7NO4S |
Hydrogen Peroxide, 30% Solution, AR, For ACS analysis, Macron Fine Chemicals™
CAS: 7722-81-1 Molecular Formula: H2O2 Molecular Weight (g/mol): 34.014 InChI Key: MHAJPDPJQMAIIY-UHFFFAOYSA-N Synonym: oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone PubChem CID: 784 IUPAC Name: hydrogen peroxide SMILES: OO
PubChem CID | 784 |
---|---|
CAS | 7722-81-1 |
Molecular Weight (g/mol) | 34.014 |
SMILES | OO |
Synonym | oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone |
IUPAC Name | hydrogen peroxide |
InChI Key | MHAJPDPJQMAIIY-UHFFFAOYSA-N |
Molecular Formula | H2O2 |
Potassium hydrogen phthalate, ACS reagent, acidimetric standard, Thermo Scientific Chemicals
CAS: 877-24-7 Molecular Formula: C8H5KO4 Molecular Weight (g/mol): 204.22 MDL Number: MFCD00013070 InChI Key: IWZKICVEHNUQTL-UHFFFAOYSA-M Synonym: potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic PubChem CID: 23676735 IUPAC Name: potassium;2-carboxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+]
PubChem CID | 23676735 |
---|---|
CAS | 877-24-7 |
Molecular Weight (g/mol) | 204.22 |
MDL Number | MFCD00013070 |
SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
Synonym | potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic |
IUPAC Name | potassium;2-carboxybenzoate |
InChI Key | IWZKICVEHNUQTL-UHFFFAOYSA-M |
Molecular Formula | C8H5KO4 |
Disodium hydrogen citrate sesquihydrate, 99%, Thermo Scientific Chemicals
CAS: 6132-05-4 Molecular Formula: C12H18Na4O17 Molecular Weight (g/mol): 526.22 MDL Number: MFCD00150445 InChI Key: HGPVLOQNBSHYEI-UHFFFAOYNA-J Synonym: unii-cz1032cekr,cz1032cekr,sodium citrate dibasic sesquihydrate,disodium citrate sesquihydrate,disodium hydrogen citrate 1.5 h2o,sodium hydrogen citrate sesquihydrate,citric acid, disodium salt, sesquihydrate,tetrasodium, 3-carboxy-3-hydroxypentanedioate, trihydrate,sodium citrate dibasic sesquihydrate, purum p.a t,1,2,3-propanetricarboxylic acid, 2-hydroxy-, disodium salt, hydrate 2:3 PubChem CID: 117063816 IUPAC Name: tetrasodium;2-(carboxymethyl)-2-hydroxybutanedioate;trihydrate SMILES: C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.O.O.O.[Na+].[Na+].[Na+].[Na+]
PubChem CID | 117063816 |
---|---|
CAS | 6132-05-4 |
Molecular Weight (g/mol) | 526.22 |
MDL Number | MFCD00150445 |
SMILES | C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.O.O.O.[Na+].[Na+].[Na+].[Na+] |
Synonym | unii-cz1032cekr,cz1032cekr,sodium citrate dibasic sesquihydrate,disodium citrate sesquihydrate,disodium hydrogen citrate 1.5 h2o,sodium hydrogen citrate sesquihydrate,citric acid, disodium salt, sesquihydrate,tetrasodium, 3-carboxy-3-hydroxypentanedioate, trihydrate,sodium citrate dibasic sesquihydrate, purum p.a t,1,2,3-propanetricarboxylic acid, 2-hydroxy-, disodium salt, hydrate 2:3 |
IUPAC Name | tetrasodium;2-(carboxymethyl)-2-hydroxybutanedioate;trihydrate |
InChI Key | HGPVLOQNBSHYEI-UHFFFAOYNA-J |
Molecular Formula | C12H18Na4O17 |
Potassium hydrogen phthalate, 99%, Thermo Scientific Chemicals
CAS: 877-24-7 Molecular Formula: C8H5KO4 Molecular Weight (g/mol): 204.222 MDL Number: MFCD00013070 InChI Key: IWZKICVEHNUQTL-UHFFFAOYSA-M Synonym: potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic PubChem CID: 23676735 IUPAC Name: potassium;2-carboxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+]
PubChem CID | 23676735 |
---|---|
CAS | 877-24-7 |
Molecular Weight (g/mol) | 204.222 |
MDL Number | MFCD00013070 |
SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
Synonym | potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic |
IUPAC Name | potassium;2-carboxybenzoate |
InChI Key | IWZKICVEHNUQTL-UHFFFAOYSA-M |
Molecular Formula | C8H5KO4 |
Tetrabutylammonium hydrogen sulfate, 99%, for HPLC, Thermo Scientific Chemicals
CAS: 32503-27-8 Molecular Formula: C16H37NO4S Molecular Weight (g/mol): 339.54 MDL Number: MFCD00011637 InChI Key: SHFJWMWCIHQNCP-UHFFFAOYSA-M Synonym: tetrabutylammonium hydrogen sulfate,tetrabutylammonium hydrogensulfate,tetrabutylammonium bisulfate,tetra-n-butylammonium hydrogen sulfate,tbahs,tetrabutylammonium sulfate 1:1,1-butanaminium, n,n,n-tributyl-, sulfate 1:1,tetrabutylammonium hydrogen sulphate,tetrabutylazanium hydrogen sulfate,ipc-tba-hs PubChem CID: 94433 IUPAC Name: hydrogen sulfate;tetrabutylazanium SMILES: OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC
PubChem CID | 94433 |
---|---|
CAS | 32503-27-8 |
Molecular Weight (g/mol) | 339.54 |
MDL Number | MFCD00011637 |
SMILES | OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC |
Synonym | tetrabutylammonium hydrogen sulfate,tetrabutylammonium hydrogensulfate,tetrabutylammonium bisulfate,tetra-n-butylammonium hydrogen sulfate,tbahs,tetrabutylammonium sulfate 1:1,1-butanaminium, n,n,n-tributyl-, sulfate 1:1,tetrabutylammonium hydrogen sulphate,tetrabutylazanium hydrogen sulfate,ipc-tba-hs |
IUPAC Name | hydrogen sulfate;tetrabutylazanium |
InChI Key | SHFJWMWCIHQNCP-UHFFFAOYSA-M |
Molecular Formula | C16H37NO4S |
Tetrabutylammonium hydrogen sulfate, 98%, Thermo Scientific Chemicals
CAS: 32503-27-8 Molecular Formula: C16H37NO4S Molecular Weight (g/mol): 339.54 MDL Number: MFCD00011637 InChI Key: SHFJWMWCIHQNCP-UHFFFAOYSA-M Synonym: tetrabutylammonium hydrogen sulfate,tetrabutylammonium hydrogensulfate,tetrabutylammonium bisulfate,tetra-n-butylammonium hydrogen sulfate,tbahs,tetrabutylammonium sulfate 1:1,1-butanaminium, n,n,n-tributyl-, sulfate 1:1,tetrabutylammonium hydrogen sulphate,tetrabutylazanium hydrogen sulfate,ipc-tba-hs PubChem CID: 94433 IUPAC Name: hydrogen sulfate;tetrabutylazanium SMILES: OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC
PubChem CID | 94433 |
---|---|
CAS | 32503-27-8 |
Molecular Weight (g/mol) | 339.54 |
MDL Number | MFCD00011637 |
SMILES | OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC |
Synonym | tetrabutylammonium hydrogen sulfate,tetrabutylammonium hydrogensulfate,tetrabutylammonium bisulfate,tetra-n-butylammonium hydrogen sulfate,tbahs,tetrabutylammonium sulfate 1:1,1-butanaminium, n,n,n-tributyl-, sulfate 1:1,tetrabutylammonium hydrogen sulphate,tetrabutylazanium hydrogen sulfate,ipc-tba-hs |
IUPAC Name | hydrogen sulfate;tetrabutylazanium |
InChI Key | SHFJWMWCIHQNCP-UHFFFAOYSA-M |
Molecular Formula | C16H37NO4S |
Tetrabutylammonium hydrogen sulfate, 99%, extra pure, Thermo Scientific Chemicals
CAS: 32503-27-8 Molecular Formula: C16H37NO4S Molecular Weight (g/mol): 339.54 MDL Number: MFCD00011637 InChI Key: SHFJWMWCIHQNCP-UHFFFAOYSA-M Synonym: tetrabutylammonium hydrogen sulfate,tetrabutylammonium hydrogensulfate,tetrabutylammonium bisulfate,tetra-n-butylammonium hydrogen sulfate,tbahs,tetrabutylammonium sulfate 1:1,1-butanaminium, n,n,n-tributyl-, sulfate 1:1,tetrabutylammonium hydrogen sulphate,tetrabutylazanium hydrogen sulfate,ipc-tba-hs PubChem CID: 94433 IUPAC Name: hydrogen sulfate;tetrabutylazanium SMILES: OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC
PubChem CID | 94433 |
---|---|
CAS | 32503-27-8 |
Molecular Weight (g/mol) | 339.54 |
MDL Number | MFCD00011637 |
SMILES | OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC |
Synonym | tetrabutylammonium hydrogen sulfate,tetrabutylammonium hydrogensulfate,tetrabutylammonium bisulfate,tetra-n-butylammonium hydrogen sulfate,tbahs,tetrabutylammonium sulfate 1:1,1-butanaminium, n,n,n-tributyl-, sulfate 1:1,tetrabutylammonium hydrogen sulphate,tetrabutylazanium hydrogen sulfate,ipc-tba-hs |
IUPAC Name | hydrogen sulfate;tetrabutylazanium |
InChI Key | SHFJWMWCIHQNCP-UHFFFAOYSA-M |
Molecular Formula | C16H37NO4S |
Tetrabutylammonium Hydrogen Sulfate 98.0+%, TCI America™
CAS: 32503-27-8 Molecular Formula: C16H37NO4S Molecular Weight (g/mol): 339.54 MDL Number: MFCD00011637 InChI Key: SHFJWMWCIHQNCP-UHFFFAOYSA-M Synonym: tetrabutylammonium hydrogen sulfate,tetrabutylammonium hydrogensulfate,tetrabutylammonium bisulfate,tetra-n-butylammonium hydrogen sulfate,tbahs,tetrabutylammonium sulfate 1:1,1-butanaminium, n,n,n-tributyl-, sulfate 1:1,tetrabutylammonium hydrogen sulphate,tetrabutylazanium hydrogen sulfate,ipc-tba-hs PubChem CID: 94433 IUPAC Name: tetrabutylazanium hydrogen sulfate SMILES: OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC
PubChem CID | 94433 |
---|---|
CAS | 32503-27-8 |
Molecular Weight (g/mol) | 339.54 |
MDL Number | MFCD00011637 |
SMILES | OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC |
Synonym | tetrabutylammonium hydrogen sulfate,tetrabutylammonium hydrogensulfate,tetrabutylammonium bisulfate,tetra-n-butylammonium hydrogen sulfate,tbahs,tetrabutylammonium sulfate 1:1,1-butanaminium, n,n,n-tributyl-, sulfate 1:1,tetrabutylammonium hydrogen sulphate,tetrabutylazanium hydrogen sulfate,ipc-tba-hs |
IUPAC Name | tetrabutylazanium hydrogen sulfate |
InChI Key | SHFJWMWCIHQNCP-UHFFFAOYSA-M |
Molecular Formula | C16H37NO4S |
Potassium hydrogen phthalate, 99.99%, acidimetric standard, Thermo Scientific Chemicals
CAS: 877-24-7 InChI Key: IWZKICVEHNUQTL-UHFFFAOYSA-M Synonym: potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic PubChem CID: 23676735 IUPAC Name: potassium;2-carboxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+]
PubChem CID | 23676735 |
---|---|
CAS | 877-24-7 |
SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
Synonym | potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic |
IUPAC Name | potassium;2-carboxybenzoate |
InChI Key | IWZKICVEHNUQTL-UHFFFAOYSA-M |
Potassium hydrogen phthalate, 99+%, Thermo Scientific Chemicals
CAS: 877-24-7 Molecular Formula: C8H5KO4 Molecular Weight (g/mol): 204.22 MDL Number: MFCD00013070 InChI Key: IWZKICVEHNUQTL-UHFFFAOYSA-M Synonym: potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic PubChem CID: 23676735 IUPAC Name: potassium;2-carboxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+]
PubChem CID | 23676735 |
---|---|
CAS | 877-24-7 |
Molecular Weight (g/mol) | 204.22 |
MDL Number | MFCD00013070 |
SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
Synonym | potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic |
IUPAC Name | potassium;2-carboxybenzoate |
InChI Key | IWZKICVEHNUQTL-UHFFFAOYSA-M |
Molecular Formula | C8H5KO4 |
L(+)-Potassium hydrogen tartrate, 99%, Thermo Scientific Chemicals
CAS: 868-14-4 Molecular Formula: C4H5KO6 Molecular Weight (g/mol): 188.18 MDL Number: MFCD00065392,MFCD00071626,MFCD00064206 InChI Key: KYKNRZGSIGMXFH-ZVGUSBNCSA-M Synonym: potassium bitartrate,l +-potassium hydrogen tartrate,potassium 3-carboxy-2,3-dihydroxypropanoate,monopotassium tartrate,potassium acid tartrate,kaliumtartrat,potassium hydrogentartrate,1-potassium hydrogentartrate,ksc657e1t,butanedioic acid, 2,3-dihydroxy-2r,3r-, potassium salt 1:1 PubChem CID: 24193652 IUPAC Name: 2,3-dihydroxybutanedioic acid;potassium SMILES: [K+].O[C@H]([C@@H](O)C([O-])=O)C(O)=O
PubChem CID | 24193652 |
---|---|
CAS | 868-14-4 |
Molecular Weight (g/mol) | 188.18 |
MDL Number | MFCD00065392,MFCD00071626,MFCD00064206 |
SMILES | [K+].O[C@H]([C@@H](O)C([O-])=O)C(O)=O |
Synonym | potassium bitartrate,l +-potassium hydrogen tartrate,potassium 3-carboxy-2,3-dihydroxypropanoate,monopotassium tartrate,potassium acid tartrate,kaliumtartrat,potassium hydrogentartrate,1-potassium hydrogentartrate,ksc657e1t,butanedioic acid, 2,3-dihydroxy-2r,3r-, potassium salt 1:1 |
IUPAC Name | 2,3-dihydroxybutanedioic acid;potassium |
InChI Key | KYKNRZGSIGMXFH-ZVGUSBNCSA-M |
Molecular Formula | C4H5KO6 |
Cholesteryl Hydrogen Succinate, MP Biomedicals™
CAS: 1510-20-9 Molecular Formula: C31H50O4 Molecular Weight (g/mol): 486.74 MDL Number: MFCD00037705 InChI Key: WLNARFZDISHUGS-MIXBDBMTSA-N Synonym: cholesteryl hemisuccinate,cholesterol hydrogen succinate,cholesteryl succinate,unii-t3j4ks4201,cholesteryl hydrogen succinate,cholest-5-en-3beta-yl hydrogen succinate,4-3beta-cholest-5-en-3-yloxy-4-oxobutanoic acid,4-3s,8s,9s,10r,13r,14s,17r-10,13-dimethyl-17-2r-6-methylheptan-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1h-cyclopenta a phenanthren-3-yl oxy-4-oxobutanoic acid,cholesterol hemisuccinate,cholesterylhemisuccinate PubChem CID: 65082 SMILES: CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(=O)CCC(O)=O
PubChem CID | 65082 |
---|---|
CAS | 1510-20-9 |
Molecular Weight (g/mol) | 486.74 |
MDL Number | MFCD00037705 |
SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(=O)CCC(O)=O |
Synonym | cholesteryl hemisuccinate,cholesterol hydrogen succinate,cholesteryl succinate,unii-t3j4ks4201,cholesteryl hydrogen succinate,cholest-5-en-3beta-yl hydrogen succinate,4-3beta-cholest-5-en-3-yloxy-4-oxobutanoic acid,4-3s,8s,9s,10r,13r,14s,17r-10,13-dimethyl-17-2r-6-methylheptan-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1h-cyclopenta a phenanthren-3-yl oxy-4-oxobutanoic acid,cholesterol hemisuccinate,cholesterylhemisuccinate |
InChI Key | WLNARFZDISHUGS-MIXBDBMTSA-N |
Molecular Formula | C31H50O4 |
Coconut Oil, Hydrogenated, MP Biomedicals™
Synonym: Coconut fat,Coconut oil from Cocos nucifera,Copra oil
Synonym | Coconut fat,Coconut oil from Cocos nucifera,Copra oil |
---|